C26H36FN — CID 67748222
2-fluoro-4-[4-[4-(4-prop-2-enylcyclohexyl)butyl]cyclohexyl]benzonitrile (PubChem CID 67748222) has the molecular formula C26H36FN and a molecular weight of 381.58 g/mol. Its IUPAC name is 2-fluoro-4-[4-[4-(4-prop-2-enylcyclohexyl)butyl]cyclohexyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[4-(4-prop-2-enylcyclohexyl)butyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 67748222 |
| Molecular Formula | C26H36FN |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | 2-fluoro-4-[4-[4-(4-prop-2-enylcyclohexyl)butyl]cyclohexyl]benzonitrile |
| SMILES | C=CCC1CCC(CCCCC2CCC(c3ccc(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H36FN/c1-2-5-20-8-10-21(11-9-20)6-3-4-7-22-12-14-23(15-13-22)24-16-17-25(19-28)26(27)18-24/h2,16-18,20-23H,1,3-15H2 |
| InChIKey | BTSDYDVKSYODMU-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|