C24H36FNSi — CID 139675581
2-fluoro-4-(9-heptyl-6-silaspiro[5.5]undecan-3-yl)benzonitrile (PubChem CID 139675581) has the molecular formula C24H36FNSi and a molecular weight of 385.64 g/mol. Its IUPAC name is 2-fluoro-4-(9-heptyl-6-silaspiro[5.5]undecan-3-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(9-heptyl-6-silaspiro[5.5]undecan-3-yl)benzonitrile |
|---|---|
| PubChem CID | 139675581 |
| Molecular Formula | C24H36FNSi |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 2-fluoro-4-(9-heptyl-6-silaspiro[5.5]undecan-3-yl)benzonitrile |
| SMILES | CCCCCCCC1CC[Si]2(CC1)CCC(c1ccc(C#N)c(F)c1)CC2 |
| InChI | InChI=1S/C24H36FNSi/c1-2-3-4-5-6-7-20-10-14-27(15-11-20)16-12-21(13-17-27)22-8-9-23(19-26)24(25)18-22/h8-9,18,20-21H,2-7,10-17H2,1H3 |
| InChIKey | VRASJQJMXDNNGK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|