C24H34FN — CID 20809571
4-[(2R,4aR,6R,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-fluorobenzonitrile (PubChem CID 20809571) has the molecular formula C24H34FN and a molecular weight of 355.54 g/mol. Its IUPAC name is 4-[(2R,4aR,6R,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[(2R,4aR,6R,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 20809571 |
| Molecular Formula | C24H34FN |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 4-[(2R,4aR,6R,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-fluorobenzonitrile |
| SMILES | CCCCCCC[C@@H]1CC[C@@H]2C[C@H](c3ccc(C#N)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C24H34FN/c1-2-3-4-5-6-7-18-8-9-20-15-21(11-10-19(20)14-18)22-12-13-23(17-26)24(25)16-22/h12-13,16,18-21H,2-11,14-15H2,1H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | CPFUCRQACIAFQC-XRXFAXGQSA-N |
| XLogP | 7.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|