C31H36F3NO2 — CID 20808016
(4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate (PubChem CID 20808016) has the molecular formula C31H36F3NO2 and a molecular weight of 511.63 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 20808016 |
| Molecular Formula | C31H36F3NO2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate |
| SMILES | CCCCCCC[C@H]1CC[C@@H]2CC(c3c(F)cc(C(=O)Oc4ccc(C#N)c(F)c4)cc3F)CC[C@H]2C1 |
| InChI | InChI=1S/C31H36F3NO2/c1-2-3-4-5-6-7-20-8-9-22-15-23(11-10-21(22)14-20)30-28(33)16-25(17-29(30)34)31(36)37-26-13-12-24(19-35)27(32)18-26/h12-13,16-18,20-23H,2-11,14-15H2,1H3/t20-,21-,22+,23?/m0/s1 |
| InChIKey | GKLROIGFBYAQLD-JYEDNEFCSA-N |
| XLogP | 8.86 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|