C30H37F2NO3 — CID 54518181
(4-cyano-3-fluorophenyl) 2-fluoro-4-[(4-nonylcyclohexyl)methoxy]benzoate (PubChem CID 54518181) has the molecular formula C30H37F2NO3 and a molecular weight of 497.63 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 2-fluoro-4-[(4-nonylcyclohexyl)methoxy]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 2-fluoro-4-[(4-nonylcyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 54518181 |
| Molecular Formula | C30H37F2NO3 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 2-fluoro-4-[(4-nonylcyclohexyl)methoxy]benzoate |
| SMILES | CCCCCCCCCC1CCC(COc2ccc(C(=O)Oc3ccc(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H37F2NO3/c1-2-3-4-5-6-7-8-9-22-10-12-23(13-11-22)21-35-25-16-17-27(29(32)18-25)30(34)36-26-15-14-24(20-33)28(31)19-26/h14-19,22-23H,2-13,21H2,1H3 |
| InChIKey | YNWMGDDAGLLEOS-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|