C29H34F3NO3 — CID 22124117
(4-cyanophenyl) 2,3,5-trifluoro-4-[(4-octylcyclohexyl)methoxy]benzoate (PubChem CID 22124117) has the molecular formula C29H34F3NO3 and a molecular weight of 501.59 g/mol. Its IUPAC name is (4-cyanophenyl) 2,3,5-trifluoro-4-[(4-octylcyclohexyl)methoxy]benzoate.
| Compound Name | (4-cyanophenyl) 2,3,5-trifluoro-4-[(4-octylcyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 22124117 |
| Molecular Formula | C29H34F3NO3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (4-cyanophenyl) 2,3,5-trifluoro-4-[(4-octylcyclohexyl)methoxy]benzoate |
| SMILES | CCCCCCCCC1CCC(COc2c(F)cc(C(=O)Oc3ccc(C#N)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H34F3NO3/c1-2-3-4-5-6-7-8-20-9-11-22(12-10-20)19-35-28-25(30)17-24(26(31)27(28)32)29(34)36-23-15-13-21(18-33)14-16-23/h13-17,20,22H,2-12,19H2,1H3 |
| InChIKey | HQOVXRANXKOEIC-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|