C26H27F4NO3 — CID 54397868
(4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(4-pentylcyclohexyl)methoxy]benzoate (PubChem CID 54397868) has the molecular formula C26H27F4NO3 and a molecular weight of 477.50 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(4-pentylcyclohexyl)methoxy]benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(4-pentylcyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 54397868 |
| Molecular Formula | C26H27F4NO3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(4-pentylcyclohexyl)methoxy]benzoate |
| SMILES | CCCCCC1CCC(COc2cc(F)c(C(=O)Oc3cc(F)c(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H27F4NO3/c1-2-3-4-5-16-6-8-17(9-7-16)15-33-18-10-23(29)25(24(30)11-18)26(32)34-19-12-21(27)20(14-31)22(28)13-19/h10-13,16-17H,2-9,15H2,1H3 |
| InChIKey | VLHQFUXBDMBWHH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|