C27H35F2NO2 — CID 22045637
(4-cyano-3,5-difluorophenyl) 7-pentyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate (PubChem CID 22045637) has the molecular formula C27H35F2NO2 and a molecular weight of 443.58 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 7-pentyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 7-pentyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 22045637 |
| Molecular Formula | C27H35F2NO2 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 7-pentyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate |
| SMILES | CCCCCC1CCC2C(CCC3CC(C(=O)Oc4cc(F)c(C#N)c(F)c4)CCC32)C1 |
| InChI | InChI=1S/C27H35F2NO2/c1-2-3-4-5-17-6-10-22-18(12-17)7-8-19-13-20(9-11-23(19)22)27(31)32-21-14-25(28)24(16-30)26(29)15-21/h14-15,17-20,22-23H,2-13H2,1H3 |
| InChIKey | DMYDIZABSDCITK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|