C27H37F2NO4 — CID 20638183
(4-cyano-3,5-difluorophenyl) 4-[(4-hexoxycyclohexyl)methoxy]cyclohexane-1-carboxylate (PubChem CID 20638183) has the molecular formula C27H37F2NO4 and a molecular weight of 477.59 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-[(4-hexoxycyclohexyl)methoxy]cyclohexane-1-carboxylate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-[(4-hexoxycyclohexyl)methoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20638183 |
| Molecular Formula | C27H37F2NO4 |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-[(4-hexoxycyclohexyl)methoxy]cyclohexane-1-carboxylate |
| SMILES | CCCCCCOC1CCC(COC2CCC(C(=O)Oc3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H37F2NO4/c1-2-3-4-5-14-32-21-10-6-19(7-11-21)18-33-22-12-8-20(9-13-22)27(31)34-23-15-25(28)24(17-30)26(29)16-23/h15-16,19-22H,2-14,18H2,1H3 |
| InChIKey | RIHXPLXFGZVJCP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|