C18H19F2NO5 — CID 59790594
(4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate (PubChem CID 59790594) has the molecular formula C18H19F2NO5 and a molecular weight of 367.35 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59790594 |
| Molecular Formula | C18H19F2NO5 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate |
| SMILES | N#Cc1c(F)cc(OC(=O)C2CCC(OCOCC3CO3)CC2)cc1F |
| InChI | InChI=1S/C18H19F2NO5/c19-16-5-13(6-17(20)15(16)7-21)26-18(22)11-1-3-12(4-2-11)25-10-23-8-14-9-24-14/h5-6,11-12,14H,1-4,8-10H2 |
| InChIKey | YSRKTUZBCWVOLE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|