About (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate
(4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate (PubChem CID 59790594) has the molecular formula C18H19F2NO5
and a molecular weight of 367.35 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate |
| PubChem CID | 59790594 |
| Molecular Formula | C18H19F2NO5 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate |
| SMILES | N#Cc1c(F)cc(OC(=O)C2CCC(OCOCC3CO3)CC2)cc1F |
| InChI | InChI=1S/C18H19F2NO5/c19-16-5-13(6-17(20)15(16)7-21)26-18(22)11-1-3-12(4-2-11)25-10-23-8-14-9-24-14/h5-6,11-12,14H,1-4,8-10H2 |
| InChIKey | YSRKTUZBCWVOLE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate?
The IUPAC name of (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate (CID 59790594) is (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate.
What is the SMILES notation for (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate?
The canonical SMILES for (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate is N#Cc1c(F)cc(OC(=O)C2CCC(OCOCC3CO3)CC2)cc1F.
What is the InChIKey of (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate?
The InChIKey is YSRKTUZBCWVOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2NO5/c19-16-5-13(6-17(20)15(16)7-21)26-18(22)11-1-3-12(4-2-11)25-10-23-8-14-9-24-14/h5-6,11-12,14H,1-4,8-10H2.
What are the key properties of (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate?
(4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate has a molecular weight of 367.35 g/mol, XLogP of 2.69, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-3,5-difluorophenyl) 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate is sourced from PubChem (CID 59790594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).