C16H18F2O4 — CID 59790892
(3,4-difluorophenyl) 4-(oxiran-2-ylmethoxy)cyclohexane-1-carboxylate (PubChem CID 59790892) has the molecular formula C16H18F2O4 and a molecular weight of 312.31 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-(oxiran-2-ylmethoxy)cyclohexane-1-carboxylate.
| Compound Name | (3,4-difluorophenyl) 4-(oxiran-2-ylmethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59790892 |
| Molecular Formula | C16H18F2O4 |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (3,4-difluorophenyl) 4-(oxiran-2-ylmethoxy)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1ccc(F)c(F)c1)C1CCC(OCC2CO2)CC1 |
| InChI | InChI=1S/C16H18F2O4/c17-14-6-5-12(7-15(14)18)22-16(19)10-1-3-11(4-2-10)20-8-13-9-21-13/h5-7,10-11,13H,1-4,8-9H2 |
| InChIKey | OGAZQUCOGSUNLH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|