C25H30F2O3 — CID 57288769
[3-fluoro-4-(4-fluorophenyl)phenyl] 4-hexoxycyclohexane-1-carboxylate (PubChem CID 57288769) has the molecular formula C25H30F2O3 and a molecular weight of 416.51 g/mol. Its IUPAC name is [3-fluoro-4-(4-fluorophenyl)phenyl] 4-hexoxycyclohexane-1-carboxylate.
| Compound Name | [3-fluoro-4-(4-fluorophenyl)phenyl] 4-hexoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 57288769 |
| Molecular Formula | C25H30F2O3 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [3-fluoro-4-(4-fluorophenyl)phenyl] 4-hexoxycyclohexane-1-carboxylate |
| SMILES | CCCCCCOC1CCC(C(=O)Oc2ccc(-c3ccc(F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H30F2O3/c1-2-3-4-5-16-29-21-12-8-19(9-13-21)25(28)30-22-14-15-23(24(27)17-22)18-6-10-20(26)11-7-18/h6-7,10-11,14-15,17,19,21H,2-5,8-9,12-13,16H2,1H3 |
| InChIKey | CTXBTCQADNRGKR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|