C52H68O6 — CID 59428989
bis[3-methyl-4-(2-methyl-4-octoxyphenyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 59428989) has the molecular formula C52H68O6 and a molecular weight of 789.11 g/mol. Its IUPAC name is bis[3-methyl-4-(2-methyl-4-octoxyphenyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[3-methyl-4-(2-methyl-4-octoxyphenyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59428989 |
| Molecular Formula | C52H68O6 |
| Molecular Weight | 789.11 g/mol |
| Exact Mass | 788.50 |
| IUPAC Name | bis[3-methyl-4-(2-methyl-4-octoxyphenyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)C3CCC(C(=O)Oc4ccc(-c5ccc(OCCCCCCCC)cc5C)c(C)c4)CC3)cc2C)c(C)c1 |
| InChI | InChI=1S/C52H68O6/c1-7-9-11-13-15-17-31-55-43-23-27-47(37(3)33-43)49-29-25-45(35-39(49)5)57-51(53)41-19-21-42(22-20-41)52(54)58-46-26-30-50(40(6)36-46)48-28-24-44(34-38(48)4)56-32-18-16-14-12-10-8-2/h23-30,33-36,41-42H,7-22,31-32H2,1-6H3 |
| InChIKey | NTNQGAJDTZGVBI-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.11 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|