C37H55NO5 — CID 14473778
4-O-[4-(4-decoxyphenyl)phenyl] 1-O-octyl piperidine-1,4-dicarboxylate (PubChem CID 14473778) has the molecular formula C37H55NO5 and a molecular weight of 593.85 g/mol. Its IUPAC name is 4-O-[4-(4-decoxyphenyl)phenyl] 1-O-octyl piperidine-1,4-dicarboxylate.
| Compound Name | 4-O-[4-(4-decoxyphenyl)phenyl] 1-O-octyl piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 14473778 |
| Molecular Formula | C37H55NO5 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.41 |
| IUPAC Name | 4-O-[4-(4-decoxyphenyl)phenyl] 1-O-octyl piperidine-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)C3CCN(C(=O)OCCCCCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C37H55NO5/c1-3-5-7-9-11-12-14-15-29-41-34-21-17-31(18-22-34)32-19-23-35(24-20-32)43-36(39)33-25-27-38(28-26-33)37(40)42-30-16-13-10-8-6-4-2/h17-24,33H,3-16,25-30H2,1-2H3 |
| InChIKey | XEZKYTLEEKTRRJ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|