C29H38O5 — CID 14716777
1-O-butyl 4-O-[4-[4-(2-methylbutoxy)phenyl]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 14716777) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-O-butyl 4-O-[4-[4-(2-methylbutoxy)phenyl]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-butyl 4-O-[4-[4-(2-methylbutoxy)phenyl]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 14716777 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 1-O-butyl 4-O-[4-[4-(2-methylbutoxy)phenyl]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)C1CCC(C(=O)Oc2ccc(-c3ccc(OCC(C)CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H38O5/c1-4-6-19-32-28(30)24-7-9-25(10-8-24)29(31)34-27-17-13-23(14-18-27)22-11-15-26(16-12-22)33-20-21(3)5-2/h11-18,21,24-25H,4-10,19-20H2,1-3H3 |
| InChIKey | LHAXXOZXCSYILT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|