C30H33FO3 — CID 70499591
[2-(4-fluorophenyl)phenyl] 4-[4-(2-methylbutoxy)phenyl]cyclohexane-1-carboxylate (PubChem CID 70499591) has the molecular formula C30H33FO3 and a molecular weight of 460.59 g/mol. Its IUPAC name is [2-(4-fluorophenyl)phenyl] 4-[4-(2-methylbutoxy)phenyl]cyclohexane-1-carboxylate.
| Compound Name | [2-(4-fluorophenyl)phenyl] 4-[4-(2-methylbutoxy)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70499591 |
| Molecular Formula | C30H33FO3 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | [2-(4-fluorophenyl)phenyl] 4-[4-(2-methylbutoxy)phenyl]cyclohexane-1-carboxylate |
| SMILES | CCC(C)COc1ccc(C2CCC(C(=O)Oc3ccccc3-c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H33FO3/c1-3-21(2)20-33-27-18-14-23(15-19-27)22-8-10-25(11-9-22)30(32)34-29-7-5-4-6-28(29)24-12-16-26(31)17-13-24/h4-7,12-19,21-22,25H,3,8-11,20H2,1-2H3 |
| InChIKey | WSRYXUNTPMXIRF-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|