C19H22FNO2 — CID 101050040
[2-(4-fluorophenyl)phenyl] N,N-di(propan-2-yl)carbamate (PubChem CID 101050040) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is [2-(4-fluorophenyl)phenyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [2-(4-fluorophenyl)phenyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 101050040 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [2-(4-fluorophenyl)phenyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)Oc1ccccc1-c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C19H22FNO2/c1-13(2)21(14(3)4)19(22)23-18-8-6-5-7-17(18)15-9-11-16(20)12-10-15/h5-14H,1-4H3 |
| InChIKey | MLUBMYIDTBZRBE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |