C20H31NO2Si — CID 100997072
[(3S)-2-methyl-3-trimethylsilyl-3H-inden-1-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 100997072) has the molecular formula C20H31NO2Si and a molecular weight of 345.56 g/mol. Its IUPAC name is [(3S)-2-methyl-3-trimethylsilyl-3H-inden-1-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(3S)-2-methyl-3-trimethylsilyl-3H-inden-1-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 100997072 |
| Molecular Formula | C20H31NO2Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [(3S)-2-methyl-3-trimethylsilyl-3H-inden-1-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC1=C(OC(=O)N(C(C)C)C(C)C)c2ccccc2[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C20H31NO2Si/c1-13(2)21(14(3)4)20(22)23-18-15(5)19(24(6,7)8)17-12-10-9-11-16(17)18/h9-14,19H,1-8H3/t19-/m1/s1 |
| InChIKey | YHQODOHRXAXTGQ-LJQANCHMSA-N |
| XLogP | 5.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|