C30H48Si4 — CID 132992519
trimethyl-[(5R,6R,11S,12S)-6,11,12-tris(trimethylsilyl)-5,6,11,12-tetrahydrotetracen-5-yl]silane (PubChem CID 132992519) has the molecular formula C30H48Si4 and a molecular weight of 521.06 g/mol. Its IUPAC name is trimethyl-[(5R,6R,11S,12S)-6,11,12-tris(trimethylsilyl)-5,6,11,12-tetrahydrotetracen-5-yl]silane.
| Compound Name | trimethyl-[(5R,6R,11S,12S)-6,11,12-tris(trimethylsilyl)-5,6,11,12-tetrahydrotetracen-5-yl]silane |
|---|---|
| PubChem CID | 132992519 |
| Molecular Formula | C30H48Si4 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | trimethyl-[(5R,6R,11S,12S)-6,11,12-tris(trimethylsilyl)-5,6,11,12-tetrahydrotetracen-5-yl]silane |
| SMILES | C[Si](C)(C)[C@@H]1C2=C([C@H]([Si](C)(C)C)c3ccccc31)[C@H]([Si](C)(C)C)c1ccccc1[C@@H]2[Si](C)(C)C |
| InChI | InChI=1S/C30H48Si4/c1-31(2,3)27-21-17-13-14-18-22(21)29(33(7,8)9)26-25(27)28(32(4,5)6)23-19-15-16-20-24(23)30(26)34(10,11)12/h13-20,27-30H,1-12H3/t27-,28-,29+,30+ |
| InChIKey | RBOSUBREPIUVJH-JCUIFQIWSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|