C8H6O — CID 87081194
8-oxatricyclo[4.3.0.07,9]nona-1,3,5-triene (PubChem CID 87081194) has the molecular formula C8H6O and a molecular weight of 118.13 g/mol. Its IUPAC name is 8-oxatricyclo[4.3.0.07,9]nona-1,3,5-triene.
| Compound Name | 8-oxatricyclo[4.3.0.07,9]nona-1,3,5-triene |
|---|---|
| PubChem CID | 87081194 |
| Molecular Formula | C8H6O |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | 8-oxatricyclo[4.3.0.07,9]nona-1,3,5-triene |
| SMILES | c1ccc2c(c1)C1OC21 |
| InChI | InChI=1S/C8H6O/c1-2-4-6-5(3-1)7-8(6)9-7/h1-4,7-8H |
| InChIKey | AJOVHQAIJONMJX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|