C32H34CoSi2 — CID 22297094
cobalt(2+);bis(1,9-dihydrofluoren-1-id-9-yl(trimethyl)silane) (PubChem CID 22297094) has the molecular formula C32H34CoSi2 and a molecular weight of 533.73 g/mol. Its IUPAC name is cobalt(2+);bis(1,9-dihydrofluoren-1-id-9-yl(trimethyl)silane).
| Compound Name | cobalt(2+);bis(1,9-dihydrofluoren-1-id-9-yl(trimethyl)silane) |
|---|---|
| PubChem CID | 22297094 |
| Molecular Formula | C32H34CoSi2 |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | cobalt(2+);bis(1,9-dihydrofluoren-1-id-9-yl(trimethyl)silane) |
| SMILES | C[Si](C)(C)C1c2[c-]cccc2-c2ccccc21.C[Si](C)(C)C1c2[c-]cccc2-c2ccccc21.[Co+2] |
| InChI | InChI=1S/2C16H17Si.Co/c2*1-17(2,3)16-14-10-6-4-8-12(14)13-9-5-7-11-15(13)16;/h2*4-10,16H,1-3H3;/q2*-1;+2 |
| InChIKey | OGKGSUGVYUVRED-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|