C40H41Cl3SiTi — CID 88593029
1,9-dihydrofluoren-1-id-9-yl-tris(3-propan-2-ylphenyl)silane;trichlorotitanium(1+) (PubChem CID 88593029) has the molecular formula C40H41Cl3SiTi and a molecular weight of 704.08 g/mol. Its IUPAC name is 1,9-dihydrofluoren-1-id-9-yl-tris(3-propan-2-ylphenyl)silane;trichlorotitanium(1+).
| Compound Name | 1,9-dihydrofluoren-1-id-9-yl-tris(3-propan-2-ylphenyl)silane;trichlorotitanium(1+) |
|---|---|
| PubChem CID | 88593029 |
| Molecular Formula | C40H41Cl3SiTi |
| Molecular Weight | 704.08 g/mol |
| Exact Mass | 702.15 |
| IUPAC Name | 1,9-dihydrofluoren-1-id-9-yl-tris(3-propan-2-ylphenyl)silane;trichlorotitanium(1+) |
| SMILES | CC(C)c1cccc([Si](c2cccc(C(C)C)c2)(c2cccc(C(C)C)c2)C2c3[c-]cccc3-c3ccccc32)c1.Cl[Ti+](Cl)Cl |
| InChI | InChI=1S/C40H41Si.3ClH.Ti/c1-27(2)30-14-11-17-33(24-30)41(34-18-12-15-31(25-34)28(3)4,35-19-13-16-32(26-35)29(5)6)40-38-22-9-7-20-36(38)37-21-8-10-23-39(37)40;;;;/h7-22,24-29,40H,1-6H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | BDKUHQYBRPIPBE-UHFFFAOYSA-K |
| XLogP | 10.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.08 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|