C18H15Cl2Hf-3 — CID 160990019
9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;hafnium;dichloride (PubChem CID 160990019) has the molecular formula C18H15Cl2Hf-3 and a molecular weight of 480.71 g/mol. Its IUPAC name is 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;hafnium;dichloride.
| Compound Name | 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;hafnium;dichloride |
|---|---|
| PubChem CID | 160990019 |
| Molecular Formula | C18H15Cl2Hf-3 |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;hafnium;dichloride |
| SMILES | [Cl-].[Cl-].[Hf].[c-]1cccc2c1C(C1C=CCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H15.2ClH.Hf/c1-2-8-13(7-1)18-16-11-5-3-9-14(16)15-10-4-6-12-17(15)18;;;/h1,3-7,9-11,13,18H,2,8H2;2*1H;/q-1;;;/p-2 |
| InChIKey | KUXVGYPMJJUGGW-UHFFFAOYSA-L |
| XLogP | -1.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|