About 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium
9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium (PubChem CID 173293563) has the molecular formula C18H15Cl2Zr-
and a molecular weight of 393.45 g/mol. Its IUPAC name is 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium.
Molecular Properties
| Compound Name | 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium |
| PubChem CID | 173293563 |
| Molecular Formula | C18H15Cl2Zr- |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium |
| SMILES | Cl[Zr]Cl.[c-]1cccc2c1C(C1C=CCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H15.2ClH.Zr/c1-2-8-13(7-1)18-16-11-5-3-9-14(16)15-10-4-6-12-17(15)18;;;/h1,3-7,9-11,13,18H,2,8H2;2*1H;/q-1;;;+2/p-2 |
| InChIKey | OYDHIBZQRJZOIO-UHFFFAOYSA-L |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium?
The IUPAC name of 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium (CID 173293563) is 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium.
What is the SMILES notation for 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium?
The canonical SMILES for 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium is Cl[Zr]Cl.[c-]1cccc2c1C(C1C=CCC1)c1ccccc1-2.
What is the InChIKey of 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium?
The InChIKey is OYDHIBZQRJZOIO-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15.2ClH.Zr/c1-2-8-13(7-1)18-16-11-5-3-9-14(16)15-10-4-6-12-17(15)18;;;/h1,3-7,9-11,13,18H,2,8H2;2*1H;/q-1;;;+2/p-2.
What are the key properties of 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium?
9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium has a molecular weight of 393.45 g/mol, XLogP of 5.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopent-2-en-1-yl-1,9-dihydrofluoren-1-ide;dichlorozirconium is sourced from PubChem (CID 173293563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).