C28H39NO2Si — CID 11733064
[(R)-(2-methylcyclohexen-1-yl)-[methyl(diphenyl)silyl]methyl] N,N-di(propan-2-yl)carbamate (PubChem CID 11733064) has the molecular formula C28H39NO2Si and a molecular weight of 449.71 g/mol. Its IUPAC name is [(R)-(2-methylcyclohexen-1-yl)-[methyl(diphenyl)silyl]methyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(R)-(2-methylcyclohexen-1-yl)-[methyl(diphenyl)silyl]methyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11733064 |
| Molecular Formula | C28H39NO2Si |
| Molecular Weight | 449.71 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | [(R)-(2-methylcyclohexen-1-yl)-[methyl(diphenyl)silyl]methyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC1=C([C@H](OC(=O)N(C(C)C)C(C)C)[Si](C)(c2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C28H39NO2Si/c1-21(2)29(22(3)4)28(30)31-27(26-20-14-13-15-23(26)5)32(6,24-16-9-7-10-17-24)25-18-11-8-12-19-25/h7-12,16-19,21-22,27H,13-15,20H2,1-6H3/t27-/m1/s1 |
| InChIKey | ZADXCOVNLSPLAC-HHHXNRCGSA-N |
| XLogP | 5.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|