C17H25NO2 — CID 102052023
[(E)-1-phenylbut-2-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 102052023) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is [(E)-1-phenylbut-2-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E)-1-phenylbut-2-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 102052023 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [(E)-1-phenylbut-2-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | C/C=C/C(OC(=O)N(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-6-10-16(15-11-8-7-9-12-15)20-17(19)18(13(2)3)14(4)5/h6-14,16H,1-5H3/b10-6+ |
| InChIKey | MDONRBWJCQXOAQ-UXBLZVDNSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|