C17H25NO2 — CID 15110199
[(E,2S)-4-phenylbut-3-en-2-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 15110199) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is [(E,2S)-4-phenylbut-3-en-2-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E,2S)-4-phenylbut-3-en-2-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 15110199 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [(E,2S)-4-phenylbut-3-en-2-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@@H](C)/C=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H25NO2/c1-13(2)18(14(3)4)17(19)20-15(5)11-12-16-9-7-6-8-10-16/h6-15H,1-5H3/b12-11+/t15-/m0/s1 |
| InChIKey | UKOQTJMDDSMADJ-RUMSDORHSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |