C13H18N2O — CID 134871242
[(E)-4-phenylbut-3-en-2-yl] N,N-dimethylcarbamimidate (PubChem CID 134871242) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is [(E)-4-phenylbut-3-en-2-yl] N,N-dimethylcarbamimidate.
| Compound Name | [(E)-4-phenylbut-3-en-2-yl] N,N-dimethylcarbamimidate |
|---|---|
| PubChem CID | 134871242 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [(E)-4-phenylbut-3-en-2-yl] N,N-dimethylcarbamimidate |
| SMILES | [H]/N=C(/OC(C)/C=C/c1ccccc1)N(C)C |
| InChI | InChI=1S/C13H18N2O/c1-11(16-13(14)15(2)3)9-10-12-7-5-4-6-8-12/h4-11,14H,1-3H3/b10-9+,14-13+ |
| InChIKey | HTQYDCJHGQLWOD-LBSPPQMYSA-N |
| XLogP | 2.60 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|