C14H15Cl3O3 — CID 101000329
[2,2,2-trichloro-1-[(E)-4-phenylbut-3-en-2-yl]oxyethyl] acetate (PubChem CID 101000329) has the molecular formula C14H15Cl3O3 and a molecular weight of 337.63 g/mol. Its IUPAC name is [2,2,2-trichloro-1-[(E)-4-phenylbut-3-en-2-yl]oxyethyl] acetate.
| Compound Name | [2,2,2-trichloro-1-[(E)-4-phenylbut-3-en-2-yl]oxyethyl] acetate |
|---|---|
| PubChem CID | 101000329 |
| Molecular Formula | C14H15Cl3O3 |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | [2,2,2-trichloro-1-[(E)-4-phenylbut-3-en-2-yl]oxyethyl] acetate |
| SMILES | CC(=O)OC(OC(C)/C=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H15Cl3O3/c1-10(8-9-12-6-4-3-5-7-12)19-13(14(15,16)17)20-11(2)18/h3-10,13H,1-2H3/b9-8+ |
| InChIKey | OGZAQLUZOCYMTR-CMDGGOBGSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|