C17H22O4 — CID 11392142
ethyl (E,3S,4R)-3-acetyloxy-4-methyl-6-phenylhex-5-enoate (PubChem CID 11392142) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl (E,3S,4R)-3-acetyloxy-4-methyl-6-phenylhex-5-enoate.
| Compound Name | ethyl (E,3S,4R)-3-acetyloxy-4-methyl-6-phenylhex-5-enoate |
|---|---|
| PubChem CID | 11392142 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl (E,3S,4R)-3-acetyloxy-4-methyl-6-phenylhex-5-enoate |
| SMILES | CCOC(=O)C[C@H](OC(C)=O)[C@H](C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H22O4/c1-4-20-17(19)12-16(21-14(3)18)13(2)10-11-15-8-6-5-7-9-15/h5-11,13,16H,4,12H2,1-3H3/b11-10+/t13-,16+/m1/s1 |
| InChIKey | JWTYHTMUMAEEMA-LAXYTXAUSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |