C18H27O5P — CID 101469617
ethyl (E,2R,3S)-2-diethoxyphosphoryl-3-methyl-5-phenylpent-4-enoate (PubChem CID 101469617) has the molecular formula C18H27O5P and a molecular weight of 354.38 g/mol. Its IUPAC name is ethyl (E,2R,3S)-2-diethoxyphosphoryl-3-methyl-5-phenylpent-4-enoate.
| Compound Name | ethyl (E,2R,3S)-2-diethoxyphosphoryl-3-methyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 101469617 |
| Molecular Formula | C18H27O5P |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | ethyl (E,2R,3S)-2-diethoxyphosphoryl-3-methyl-5-phenylpent-4-enoate |
| SMILES | CCOC(=O)[C@@H]([C@@H](C)/C=C/c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H27O5P/c1-5-21-18(19)17(24(20,22-6-2)23-7-3)15(4)13-14-16-11-9-8-10-12-16/h8-15,17H,5-7H2,1-4H3/b14-13+/t15-,17+/m0/s1 |
| InChIKey | AQKDQJCLVUKATK-DKBMBFQUSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|