C13H19O4P — CID 12543687
(E,1S)-1-diethoxyphosphoryl-3-phenylprop-2-en-1-ol (PubChem CID 12543687) has the molecular formula C13H19O4P and a molecular weight of 270.26 g/mol. Its IUPAC name is (E,1S)-1-diethoxyphosphoryl-3-phenylprop-2-en-1-ol.
| Compound Name | (E,1S)-1-diethoxyphosphoryl-3-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 12543687 |
| Molecular Formula | C13H19O4P |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (E,1S)-1-diethoxyphosphoryl-3-phenylprop-2-en-1-ol |
| SMILES | CCOP(=O)(OCC)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H19O4P/c1-3-16-18(15,17-4-2)13(14)11-10-12-8-6-5-7-9-12/h5-11,13-14H,3-4H2,1-2H3/b11-10+/t13-/m0/s1 |
| InChIKey | VDTIGZIBQSKVCQ-NHAQELONSA-N |
| XLogP | 3.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|