C28H32NO5P — CID 46180209
(E)-2-[benzyl-[diethoxyphosphoryl(phenyl)methyl]amino]-4-phenylbut-3-enoic acid (PubChem CID 46180209) has the molecular formula C28H32NO5P and a molecular weight of 493.54 g/mol. Its IUPAC name is (E)-2-[benzyl-[diethoxyphosphoryl(phenyl)methyl]amino]-4-phenylbut-3-enoic acid.
| Compound Name | (E)-2-[benzyl-[diethoxyphosphoryl(phenyl)methyl]amino]-4-phenylbut-3-enoic acid |
|---|---|
| PubChem CID | 46180209 |
| Molecular Formula | C28H32NO5P |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (E)-2-[benzyl-[diethoxyphosphoryl(phenyl)methyl]amino]-4-phenylbut-3-enoic acid |
| SMILES | CCOP(=O)(OCC)C(c1ccccc1)N(Cc1ccccc1)C(/C=C/c1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H32NO5P/c1-3-33-35(32,34-4-2)27(25-18-12-7-13-19-25)29(22-24-16-10-6-11-17-24)26(28(30)31)21-20-23-14-8-5-9-15-23/h5-21,26-27H,3-4,22H2,1-2H3,(H,30,31)/b21-20+ |
| InChIKey | IPWNUQOGQIVMEL-QZQOTICOSA-N |
| XLogP | 6.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|