C25H36NO5P — CID 101089814
(3S)-N-benzyl-3-diethoxyphosphoryl-N-[(1R)-2-hydroxy-1-phenylethyl]-4-methylpentanamide (PubChem CID 101089814) has the molecular formula C25H36NO5P and a molecular weight of 461.54 g/mol. Its IUPAC name is (3S)-N-benzyl-3-diethoxyphosphoryl-N-[(1R)-2-hydroxy-1-phenylethyl]-4-methylpentanamide.
| Compound Name | (3S)-N-benzyl-3-diethoxyphosphoryl-N-[(1R)-2-hydroxy-1-phenylethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 101089814 |
| Molecular Formula | C25H36NO5P |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (3S)-N-benzyl-3-diethoxyphosphoryl-N-[(1R)-2-hydroxy-1-phenylethyl]-4-methylpentanamide |
| SMILES | CCOP(=O)(OCC)[C@@H](CC(=O)N(Cc1ccccc1)[C@@H](CO)c1ccccc1)C(C)C |
| InChI | InChI=1S/C25H36NO5P/c1-5-30-32(29,31-6-2)24(20(3)4)17-25(28)26(18-21-13-9-7-10-14-21)23(19-27)22-15-11-8-12-16-22/h7-16,20,23-24,27H,5-6,17-19H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | IQMFAMKIIDOKIG-ZEQRLZLVSA-N |
| XLogP | 5.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|