C14H20NO3- — CID 57368596
N-benzyl-N-(1-hydroxy-3-methylpentan-2-yl)carbamate (PubChem CID 57368596) has the molecular formula C14H20NO3- and a molecular weight of 250.32 g/mol. Its IUPAC name is N-benzyl-N-(1-hydroxy-3-methylpentan-2-yl)carbamate.
| Compound Name | N-benzyl-N-(1-hydroxy-3-methylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 57368596 |
| Molecular Formula | C14H20NO3- |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-benzyl-N-(1-hydroxy-3-methylpentan-2-yl)carbamate |
| SMILES | CCC(C)C(CO)N(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C14H21NO3/c1-3-11(2)13(10-16)15(14(17)18)9-12-7-5-4-6-8-12/h4-8,11,13,16H,3,9-10H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | SCMXKFUXJBPYFB-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |