C15H16N3O3- — CID 22849591
N-benzyl-N-[(2S)-1-oxo-1-(pyrrol-1-ylamino)propan-2-yl]carbamate (PubChem CID 22849591) has the molecular formula C15H16N3O3- and a molecular weight of 286.31 g/mol. Its IUPAC name is N-benzyl-N-[(2S)-1-oxo-1-(pyrrol-1-ylamino)propan-2-yl]carbamate.
| Compound Name | N-benzyl-N-[(2S)-1-oxo-1-(pyrrol-1-ylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 22849591 |
| Molecular Formula | C15H16N3O3- |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-benzyl-N-[(2S)-1-oxo-1-(pyrrol-1-ylamino)propan-2-yl]carbamate |
| SMILES | C[C@@H](C(=O)Nn1cccc1)N(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C15H17N3O3/c1-12(14(19)16-17-9-5-6-10-17)18(15(20)21)11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3,(H,16,19)(H,20,21)/p-1/t12-/m0/s1 |
| InChIKey | ZPURAIIFOYDOSX-LBPRGKRZSA-M |
| XLogP | 0.79 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |