C12H14F2NO4S- — CID 57361505
N-benzyl-N-(1-ethylsulfonyl-2,2-difluoroethyl)carbamate (PubChem CID 57361505) has the molecular formula C12H14F2NO4S- and a molecular weight of 306.31 g/mol. Its IUPAC name is N-benzyl-N-(1-ethylsulfonyl-2,2-difluoroethyl)carbamate.
| Compound Name | N-benzyl-N-(1-ethylsulfonyl-2,2-difluoroethyl)carbamate |
|---|---|
| PubChem CID | 57361505 |
| Molecular Formula | C12H14F2NO4S- |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-benzyl-N-(1-ethylsulfonyl-2,2-difluoroethyl)carbamate |
| SMILES | CCS(=O)(=O)C(C(F)F)N(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C12H15F2NO4S/c1-2-20(18,19)11(10(13)14)15(12(16)17)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3,(H,16,17)/p-1 |
| InChIKey | IXSAZUPBANJEDQ-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |