C20H28NO4P — CID 11314906
(2S)-2-[benzyl(diethoxyphosphorylmethyl)amino]-2-phenylethanol (PubChem CID 11314906) has the molecular formula C20H28NO4P and a molecular weight of 377.42 g/mol. Its IUPAC name is (2S)-2-[benzyl(diethoxyphosphorylmethyl)amino]-2-phenylethanol.
| Compound Name | (2S)-2-[benzyl(diethoxyphosphorylmethyl)amino]-2-phenylethanol |
|---|---|
| PubChem CID | 11314906 |
| Molecular Formula | C20H28NO4P |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2S)-2-[benzyl(diethoxyphosphorylmethyl)amino]-2-phenylethanol |
| SMILES | CCOP(=O)(CN(Cc1ccccc1)[C@H](CO)c1ccccc1)OCC |
| InChI | InChI=1S/C20H28NO4P/c1-3-24-26(23,25-4-2)17-21(15-18-11-7-5-8-12-18)20(16-22)19-13-9-6-10-14-19/h5-14,20,22H,3-4,15-17H2,1-2H3/t20-/m1/s1 |
| InChIKey | SOOQKYSTUNGYLF-HXUWFJFHSA-N |
| XLogP | 4.45 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|