C14H23N2O4P — CID 10781532
3-benzyl-1-(diethoxyphosphorylmethyl)-1-methylurea (PubChem CID 10781532) has the molecular formula C14H23N2O4P and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-benzyl-1-(diethoxyphosphorylmethyl)-1-methylurea.
| Compound Name | 3-benzyl-1-(diethoxyphosphorylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 10781532 |
| Molecular Formula | C14H23N2O4P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-benzyl-1-(diethoxyphosphorylmethyl)-1-methylurea |
| SMILES | CCOP(=O)(CN(C)C(=O)NCc1ccccc1)OCC |
| InChI | InChI=1S/C14H23N2O4P/c1-4-19-21(18,20-5-2)12-16(3)14(17)15-11-13-9-7-6-8-10-13/h6-10H,4-5,11-12H2,1-3H3,(H,15,17) |
| InChIKey | GJUVYNVMFORAMV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|