C16H21N2O2P — CID 13438203
N-[(benzylamino)-ethoxyphosphoryl]-1-phenylmethanamine (PubChem CID 13438203) has the molecular formula C16H21N2O2P and a molecular weight of 304.33 g/mol. Its IUPAC name is N-[(benzylamino)-ethoxyphosphoryl]-1-phenylmethanamine.
| Compound Name | N-[(benzylamino)-ethoxyphosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 13438203 |
| Molecular Formula | C16H21N2O2P |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[(benzylamino)-ethoxyphosphoryl]-1-phenylmethanamine |
| SMILES | CCOP(=O)(NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C16H21N2O2P/c1-2-20-21(19,17-13-15-9-5-3-6-10-15)18-14-16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3,(H2,17,18,19) |
| InChIKey | NFFSUTLFGVEMTB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|