C15H18NOPS — CID 102380213
N-[ethoxy(phenyl)phosphinothioyl]-1-phenylmethanamine (PubChem CID 102380213) has the molecular formula C15H18NOPS and a molecular weight of 291.36 g/mol. Its IUPAC name is N-[ethoxy(phenyl)phosphinothioyl]-1-phenylmethanamine.
| Compound Name | N-[ethoxy(phenyl)phosphinothioyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 102380213 |
| Molecular Formula | C15H18NOPS |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[ethoxy(phenyl)phosphinothioyl]-1-phenylmethanamine |
| SMILES | CCOP(=S)(NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18NOPS/c1-2-17-18(19,15-11-7-4-8-12-15)16-13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,16,19) |
| InChIKey | DNJDRYSRYDDILV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|