C9H12KO2PS2 — CID 70633644
potassium benzylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane (PubChem CID 70633644) has the molecular formula C9H12KO2PS2 and a molecular weight of 286.40 g/mol. Its IUPAC name is potassium benzylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane.
| Compound Name | potassium benzylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 70633644 |
| Molecular Formula | C9H12KO2PS2 |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | potassium benzylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane |
| SMILES | CCOP([O-])(=S)SCc1ccccc1.[K+] |
| InChI | InChI=1S/C9H13O2PS2.K/c1-2-11-12(10,13)14-8-9-6-4-3-5-7-9;/h3-7H,2,8H2,1H3,(H,10,13);/q;+1/p-1 |
| InChIKey | PQGNVHBMVURRBC-UHFFFAOYSA-M |
| XLogP | -0.45 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|