About trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate
trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate (PubChem CID 175857354) has the molecular formula C14H14O6P2S4Zn3
and a molecular weight of 664.65 g/mol. Its IUPAC name is trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate.
Molecular Properties
| Compound Name | trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate |
| PubChem CID | 175857354 |
| Molecular Formula | C14H14O6P2S4Zn3 |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 659.70 |
| IUPAC Name | trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate |
| SMILES | [O-]P([O-])([O-])=S.[O-]P([O-])([O-])=S.[Zn+2].[Zn+2].[Zn+2].c1ccc(CSSCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14S2.2H3O3PS.3Zn/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14;2*1-4(2,3)5;;;/h1-10H,11-12H2;2*(H3,1,2,3,5);;;/q;;;3*+2/p-6 |
| InChIKey | KOYAWNWCZYNVJD-UHFFFAOYSA-H |
| XLogP | -0.66 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate?
The IUPAC name of trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate (CID 175857354) is trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate.
What is the SMILES notation for trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate?
The canonical SMILES for trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate is [O-]P([O-])([O-])=S.[O-]P([O-])([O-])=S.[Zn+2].[Zn+2].[Zn+2].c1ccc(CSSCc2ccccc2)cc1.
What is the InChIKey of trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate?
The InChIKey is KOYAWNWCZYNVJD-UHFFFAOYSA-H. The full InChI is InChI=1S/C14H14S2.2H3O3PS.3Zn/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14;2*1-4(2,3)5;;;/h1-10H,11-12H2;2*(H3,1,2,3,5);;;/q;;;3*+2/p-6.
What are the key properties of trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate?
trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate has a molecular weight of 664.65 g/mol, XLogP of -0.66, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for trizinc;(benzyldisulfanyl)methylbenzene;dithiophosphate is sourced from PubChem (CID 175857354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).