About (benzyldisulfanyl)methylbenzene;carbamic acid
(benzyldisulfanyl)methylbenzene;carbamic acid (PubChem CID 159723781) has the molecular formula C15H17NO2S2
and a molecular weight of 307.44 g/mol. Its IUPAC name is (benzyldisulfanyl)methylbenzene;carbamic acid.
Molecular Properties
| Compound Name | (benzyldisulfanyl)methylbenzene;carbamic acid |
| PubChem CID | 159723781 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (benzyldisulfanyl)methylbenzene;carbamic acid |
| SMILES | NC(=O)O.c1ccc(CSSCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14S2.CH3NO2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14;2-1(3)4/h1-10H,11-12H2;2H2,(H,3,4) |
| InChIKey | NAJIXKHGKOFZSN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (benzyldisulfanyl)methylbenzene;carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (benzyldisulfanyl)methylbenzene;carbamic acid?
The IUPAC name of (benzyldisulfanyl)methylbenzene;carbamic acid (CID 159723781) is (benzyldisulfanyl)methylbenzene;carbamic acid.
What is the SMILES notation for (benzyldisulfanyl)methylbenzene;carbamic acid?
The canonical SMILES for (benzyldisulfanyl)methylbenzene;carbamic acid is NC(=O)O.c1ccc(CSSCc2ccccc2)cc1.
What is the InChIKey of (benzyldisulfanyl)methylbenzene;carbamic acid?
The InChIKey is NAJIXKHGKOFZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S2.CH3NO2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14;2-1(3)4/h1-10H,11-12H2;2H2,(H,3,4).
What are the key properties of (benzyldisulfanyl)methylbenzene;carbamic acid?
(benzyldisulfanyl)methylbenzene;carbamic acid has a molecular weight of 307.44 g/mol, XLogP of 4.39, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (benzyldisulfanyl)methylbenzene;carbamic acid is sourced from PubChem (CID 159723781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).