C20H26NO4P — CID 11100843
N,N-dibenzyl-2-diethoxyphosphorylacetamide (PubChem CID 11100843) has the molecular formula C20H26NO4P and a molecular weight of 375.41 g/mol. Its IUPAC name is N,N-dibenzyl-2-diethoxyphosphorylacetamide.
| Compound Name | N,N-dibenzyl-2-diethoxyphosphorylacetamide |
|---|---|
| PubChem CID | 11100843 |
| Molecular Formula | C20H26NO4P |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N,N-dibenzyl-2-diethoxyphosphorylacetamide |
| SMILES | CCOP(=O)(CC(=O)N(Cc1ccccc1)Cc1ccccc1)OCC |
| InChI | InChI=1S/C20H26NO4P/c1-3-24-26(23,25-4-2)17-20(22)21(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14H,3-4,15-17H2,1-2H3 |
| InChIKey | AGDUQUSOWUDCIG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|