C27H37N2O6P — CID 11168275
2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-N-tert-butyl-4-oxo-4-phenylbutanamide (PubChem CID 11168275) has the molecular formula C27H37N2O6P and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-N-tert-butyl-4-oxo-4-phenylbutanamide.
| Compound Name | 2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-N-tert-butyl-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 11168275 |
| Molecular Formula | C27H37N2O6P |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-N-tert-butyl-4-oxo-4-phenylbutanamide |
| SMILES | CCOP(=O)(CC(=O)N(Cc1ccccc1)C(CC(=O)c1ccccc1)C(=O)NC(C)(C)C)OCC |
| InChI | InChI=1S/C27H37N2O6P/c1-6-34-36(33,35-7-2)20-25(31)29(19-21-14-10-8-11-15-21)23(26(32)28-27(3,4)5)18-24(30)22-16-12-9-13-17-22/h8-17,23H,6-7,18-20H2,1-5H3,(H,28,32) |
| InChIKey | MSEKRLNMKOAGQX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|