C24H32IN3O4S — CID 132747086
2-[benzyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-tert-butylbutanamide (PubChem CID 132747086) has the molecular formula C24H32IN3O4S and a molecular weight of 585.51 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-tert-butylbutanamide.
| Compound Name | 2-[benzyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-tert-butylbutanamide |
|---|---|
| PubChem CID | 132747086 |
| Molecular Formula | C24H32IN3O4S |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | 2-[benzyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-tert-butylbutanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1ccccc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H32IN3O4S/c1-6-21(23(30)26-24(2,3)4)27(16-18-10-8-7-9-11-18)22(29)17-28(33(5,31)32)20-14-12-19(25)13-15-20/h7-15,21H,6,16-17H2,1-5H3,(H,26,30) |
| InChIKey | GXYXPUUYCBFZPH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|