C24H31FIN3O4S — CID 132750851
N-tert-butyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide (PubChem CID 132750851) has the molecular formula C24H31FIN3O4S and a molecular weight of 603.50 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132750851 |
| Molecular Formula | C24H31FIN3O4S |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | N-tert-butyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1ccc(F)cc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H31FIN3O4S/c1-6-21(23(31)27-24(2,3)4)28(15-17-7-9-18(25)10-8-17)22(30)16-29(34(5,32)33)20-13-11-19(26)12-14-20/h7-14,21H,6,15-16H2,1-5H3,(H,27,31) |
| InChIKey | BRQXIQAAMMDKBV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|