C26H33FIN3O4S — CID 100565816
(2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide (PubChem CID 100565816) has the molecular formula C26H33FIN3O4S and a molecular weight of 629.54 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100565816 |
| Molecular Formula | C26H33FIN3O4S |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(F)cc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H33FIN3O4S/c1-3-24(26(33)29-22-7-5-4-6-8-22)30(17-19-9-11-20(27)12-10-19)25(32)18-31(36(2,34)35)23-15-13-21(28)14-16-23/h9-16,22,24H,3-8,17-18H2,1-2H3,(H,29,33)/t24-/m1/s1 |
| InChIKey | QCFWYAWKHYBFDM-XMMPIXPASA-N |
| XLogP | 4.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|