C25H30Cl2IN3O4S — CID 132645033
N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide (PubChem CID 132645033) has the molecular formula C25H30Cl2IN3O4S and a molecular weight of 666.41 g/mol. Its IUPAC name is N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132645033 |
| Molecular Formula | C25H30Cl2IN3O4S |
| Molecular Weight | 666.41 g/mol |
| Exact Mass | 665.04 |
| IUPAC Name | N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H30Cl2IN3O4S/c1-3-23(25(33)29-19-6-4-5-7-19)30(15-17-8-13-21(26)22(27)14-17)24(32)16-31(36(2,34)35)20-11-9-18(28)10-12-20/h8-14,19,23H,3-7,15-16H2,1-2H3,(H,29,33) |
| InChIKey | QFMSXYBQYHRKJV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|